C51H100O5 — CID 169321403
bis(2-heptylnonyl) 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 169321403) has the molecular formula C51H100O5 and a molecular weight of 793.36 g/mol. Its IUPAC name is bis(2-heptylnonyl) 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | bis(2-heptylnonyl) 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321403 |
| Molecular Formula | C51H100O5 |
| Molecular Weight | 793.36 g/mol |
| Exact Mass | 792.76 |
| IUPAC Name | bis(2-heptylnonyl) 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CCCCCCCC(CCCCCCC)COC(=O)C(C)(C)CCCCCC(O)CCCCCC(C)(C)C(=O)OCC(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C51H100O5/c1-9-13-17-21-27-35-45(36-28-22-18-14-10-2)43-55-48(53)50(5,6)41-33-25-31-39-47(52)40-32-26-34-42-51(7,8)49(54)56-44-46(37-29-23-19-15-11-3)38-30-24-20-16-12-4/h45-47,52H,9-44H2,1-8H3 |
| InChIKey | TYSZAGHZEJNNSY-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.36 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|