C32H62O4 — CID 176756076
8,14,14-trimethyl-15-oxo-15-(4-pentylnonoxy)pentadecanoic acid (PubChem CID 176756076) has the molecular formula C32H62O4 and a molecular weight of 510.84 g/mol. Its IUPAC name is 8,14,14-trimethyl-15-oxo-15-(4-pentylnonoxy)pentadecanoic acid.
| Compound Name | 8,14,14-trimethyl-15-oxo-15-(4-pentylnonoxy)pentadecanoic acid |
|---|---|
| PubChem CID | 176756076 |
| Molecular Formula | C32H62O4 |
| Molecular Weight | 510.84 g/mol |
| Exact Mass | 510.46 |
| IUPAC Name | 8,14,14-trimethyl-15-oxo-15-(4-pentylnonoxy)pentadecanoic acid |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)C(C)(C)CCCCCC(C)CCCCCCC(=O)O |
| InChI | InChI=1S/C32H62O4/c1-6-8-13-22-29(23-14-9-7-2)24-19-27-36-31(35)32(4,5)26-18-12-16-21-28(3)20-15-10-11-17-25-30(33)34/h28-29H,6-27H2,1-5H3,(H,33,34) |
| InChIKey | SZSDISXTEDCYGD-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.84 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|