About 7-methyloctadecanoic acid;8-methyloctadecanoic acid
7-methyloctadecanoic acid;8-methyloctadecanoic acid (PubChem CID 157148422) has the molecular formula C38H76O4
and a molecular weight of 597.02 g/mol. Its IUPAC name is 7-methyloctadecanoic acid;8-methyloctadecanoic acid.
Molecular Properties
| Compound Name | 7-methyloctadecanoic acid;8-methyloctadecanoic acid |
| PubChem CID | 157148422 |
| Molecular Formula | C38H76O4 |
| Molecular Weight | 597.02 g/mol |
| Exact Mass | 596.57 |
| IUPAC Name | 7-methyloctadecanoic acid;8-methyloctadecanoic acid |
| SMILES | CCCCCCCCCCC(C)CCCCCCC(=O)O.CCCCCCCCCCCC(C)CCCCCC(=O)O |
| InChI | InChI=1S/2C19H38O2/c1-3-4-5-6-7-8-9-12-15-18(2)16-13-10-11-14-17-19(20)21;1-3-4-5-6-7-8-9-10-12-15-18(2)16-13-11-14-17-19(20)21/h2*18H,3-17H2,1-2H3,(H,20,21) |
| InChIKey | AKYZNTYQMRHBLO-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.02 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyloctadecanoic acid;8-methyloctadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyloctadecanoic acid;8-methyloctadecanoic acid?
The IUPAC name of 7-methyloctadecanoic acid;8-methyloctadecanoic acid (CID 157148422) is 7-methyloctadecanoic acid;8-methyloctadecanoic acid.
What is the SMILES notation for 7-methyloctadecanoic acid;8-methyloctadecanoic acid?
The canonical SMILES for 7-methyloctadecanoic acid;8-methyloctadecanoic acid is CCCCCCCCCCC(C)CCCCCCC(=O)O.CCCCCCCCCCCC(C)CCCCCC(=O)O.
What is the InChIKey of 7-methyloctadecanoic acid;8-methyloctadecanoic acid?
The InChIKey is AKYZNTYQMRHBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H38O2/c1-3-4-5-6-7-8-9-12-15-18(2)16-13-10-11-14-17-19(20)21;1-3-4-5-6-7-8-9-10-12-15-18(2)16-13-11-14-17-19(20)21/h2*18H,3-17H2,1-2H3,(H,20,21).
What are the key properties of 7-methyloctadecanoic acid;8-methyloctadecanoic acid?
7-methyloctadecanoic acid;8-methyloctadecanoic acid has a molecular weight of 597.02 g/mol, XLogP of 13.16, 32 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyloctadecanoic acid;8-methyloctadecanoic acid is sourced from PubChem (CID 157148422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).