About 8-hydroxypentadecanoic acid;11-methylhenicosane
8-hydroxypentadecanoic acid;11-methylhenicosane (PubChem CID 175544525) has the molecular formula C37H76O3
and a molecular weight of 569.01 g/mol. Its IUPAC name is 8-hydroxypentadecanoic acid;11-methylhenicosane.
Molecular Properties
| Compound Name | 8-hydroxypentadecanoic acid;11-methylhenicosane |
| PubChem CID | 175544525 |
| Molecular Formula | C37H76O3 |
| Molecular Weight | 569.01 g/mol |
| Exact Mass | 568.58 |
| IUPAC Name | 8-hydroxypentadecanoic acid;11-methylhenicosane |
| SMILES | CCCCCCCC(O)CCCCCCC(=O)O.CCCCCCCCCCC(C)CCCCCCCCCC |
| InChI | InChI=1S/C22H46.C15H30O3/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2;1-2-3-4-5-8-11-14(16)12-9-6-7-10-13-15(17)18/h22H,4-21H2,1-3H3;14,16H,2-13H2,1H3,(H,17,18) |
| InChIKey | OLZLPBJMSCZOEB-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.01 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxypentadecanoic acid;11-methylhenicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxypentadecanoic acid;11-methylhenicosane?
The IUPAC name of 8-hydroxypentadecanoic acid;11-methylhenicosane (CID 175544525) is 8-hydroxypentadecanoic acid;11-methylhenicosane.
What is the SMILES notation for 8-hydroxypentadecanoic acid;11-methylhenicosane?
The canonical SMILES for 8-hydroxypentadecanoic acid;11-methylhenicosane is CCCCCCCC(O)CCCCCCC(=O)O.CCCCCCCCCCC(C)CCCCCCCCCC.
What is the InChIKey of 8-hydroxypentadecanoic acid;11-methylhenicosane?
The InChIKey is OLZLPBJMSCZOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46.C15H30O3/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2;1-2-3-4-5-8-11-14(16)12-9-6-7-10-13-15(17)18/h22H,4-21H2,1-3H3;14,16H,2-13H2,1H3,(H,17,18).
What are the key properties of 8-hydroxypentadecanoic acid;11-methylhenicosane?
8-hydroxypentadecanoic acid;11-methylhenicosane has a molecular weight of 569.01 g/mol, XLogP of 12.82, 31 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxypentadecanoic acid;11-methylhenicosane is sourced from PubChem (CID 175544525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).