C55H110N2O5 — CID 169321458
bis[2-(dioctylamino)ethyl] 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 169321458) has the molecular formula C55H110N2O5 and a molecular weight of 879.49 g/mol. Its IUPAC name is bis[2-(dioctylamino)ethyl] 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | bis[2-(dioctylamino)ethyl] 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321458 |
| Molecular Formula | C55H110N2O5 |
| Molecular Weight | 879.49 g/mol |
| Exact Mass | 878.84 |
| IUPAC Name | bis[2-(dioctylamino)ethyl] 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CCCCCCCCN(CCCCCCCC)CCOC(=O)C(C)(C)CCCCCC(O)CCCCCC(C)(C)C(=O)OCCN(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C55H110N2O5/c1-9-13-17-21-25-35-43-56(44-36-26-22-18-14-10-2)47-49-61-52(59)54(5,6)41-33-29-31-39-51(58)40-32-30-34-42-55(7,8)53(60)62-50-48-57(45-37-27-23-19-15-11-3)46-38-28-24-20-16-12-4/h51,58H,9-50H2,1-8H3 |
| InChIKey | NDVRLDWLYCFSOW-UHFFFAOYSA-N |
| XLogP | 15.43 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.49 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|