C46H91NO6 — CID 176602883
heptadecan-9-yl 8-[3-hydroxypropyl(6-nonoxycarbonyloxyhexyl)amino]-2,2-dimethyloctanoate (PubChem CID 176602883) has the molecular formula C46H91NO6 and a molecular weight of 754.23 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-hydroxypropyl(6-nonoxycarbonyloxyhexyl)amino]-2,2-dimethyloctanoate.
| Compound Name | heptadecan-9-yl 8-[3-hydroxypropyl(6-nonoxycarbonyloxyhexyl)amino]-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 176602883 |
| Molecular Formula | C46H91NO6 |
| Molecular Weight | 754.23 g/mol |
| Exact Mass | 753.68 |
| IUPAC Name | heptadecan-9-yl 8-[3-hydroxypropyl(6-nonoxycarbonyloxyhexyl)amino]-2,2-dimethyloctanoate |
| SMILES | CCCCCCCCCOC(=O)OCCCCCCN(CCCO)CCCCCCC(C)(C)C(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C46H91NO6/c1-6-9-12-15-18-24-31-41-51-45(50)52-42-32-25-23-30-38-47(39-33-40-48)37-29-22-21-28-36-46(4,5)44(49)53-43(34-26-19-16-13-10-7-2)35-27-20-17-14-11-8-3/h43,48H,6-42H2,1-5H3 |
| InChIKey | LJXCZAKBNIICTP-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.23 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|