C55H107NO7 — CID 170431569
dioctyl 2-[8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octyl]-2-methylpropanedioate (PubChem CID 170431569) has the molecular formula C55H107NO7 and a molecular weight of 894.46 g/mol. Its IUPAC name is dioctyl 2-[8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octyl]-2-methylpropanedioate.
| Compound Name | dioctyl 2-[8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 170431569 |
| Molecular Formula | C55H107NO7 |
| Molecular Weight | 894.46 g/mol |
| Exact Mass | 893.80 |
| IUPAC Name | dioctyl 2-[8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octyl]-2-methylpropanedioate |
| SMILES | CCCCCCCCOC(=O)C(C)(CCCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C55H107NO7/c1-6-10-14-18-25-33-41-51(42-34-26-19-15-11-7-2)63-52(58)43-35-27-24-30-38-46-56(47-48-57)45-37-29-23-22-28-36-44-55(5,53(59)61-49-39-31-20-16-12-8-3)54(60)62-50-40-32-21-17-13-9-4/h51,57H,6-50H2,1-5H3 |
| InChIKey | MISBRGWIHCLPTP-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.46 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|