C39H77NO5 — CID 170431276
dioctyl 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-methylpropanedioate (PubChem CID 170431276) has the molecular formula C39H77NO5 and a molecular weight of 640.05 g/mol. Its IUPAC name is dioctyl 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-methylpropanedioate.
| Compound Name | dioctyl 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 170431276 |
| Molecular Formula | C39H77NO5 |
| Molecular Weight | 640.05 g/mol |
| Exact Mass | 639.58 |
| IUPAC Name | dioctyl 2-[6-[decyl(3-hydroxypropyl)amino]hexyl]-2-methylpropanedioate |
| SMILES | CCCCCCCCCCN(CCCO)CCCCCCC(C)(C(=O)OCCCCCCCC)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C39H77NO5/c1-5-8-11-14-17-18-20-25-31-40(33-29-34-41)32-26-21-19-24-30-39(4,37(42)44-35-27-22-15-12-9-6-2)38(43)45-36-28-23-16-13-10-7-3/h41H,5-36H2,1-4H3 |
| InChIKey | HNBJIKJBELZEHN-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.05 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|