About 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate
5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate (PubChem CID 168999434) has the molecular formula C57H112N2O10
and a molecular weight of 985.53 g/mol. Its IUPAC name is 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate.
Molecular Properties
| Compound Name | 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate |
| PubChem CID | 168999434 |
| Molecular Formula | C57H112N2O10 |
| Molecular Weight | 985.53 g/mol |
| Exact Mass | 984.83 |
| IUPAC Name | 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate |
| SMILES | CCCCCCCCCCOC(=O)OCCCCCN(CCCCCCO)CCCN(CCCCCOC(=O)OCCCCCCCCCC)CCCCCOC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C57H112N2O10/c1-4-7-10-13-16-19-24-35-49-64-55(61)67-52-38-27-31-43-58(42-30-22-23-34-48-60)46-41-47-59(44-32-28-39-53-68-56(62)65-50-36-25-20-17-14-11-8-5-2)45-33-29-40-54-69-57(63)66-51-37-26-21-18-15-12-9-6-3/h60H,4-54H2,1-3H3 |
| InChIKey | HQPBRBHBKFLCMI-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 985.53 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate?
The IUPAC name of 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate (CID 168999434) is 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate.
What is the SMILES notation for 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate?
The canonical SMILES for 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate is CCCCCCCCCCOC(=O)OCCCCCN(CCCCCCO)CCCN(CCCCCOC(=O)OCCCCCCCCCC)CCCCCOC(=O)OCCCCCCCCCC.
What is the InChIKey of 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate?
The InChIKey is HQPBRBHBKFLCMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H112N2O10/c1-4-7-10-13-16-19-24-35-49-64-55(61)67-52-38-27-31-43-58(42-30-22-23-34-48-60)46-41-47-59(44-32-28-39-53-68-56(62)65-50-36-25-20-17-14-11-8-5-2)45-33-29-40-54-69-57(63)66-51-37-26-21-18-15-12-9-6-3/h60H,4-54H2,1-3H3.
What are the key properties of 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate?
5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate has a molecular weight of 985.53 g/mol, XLogP of 15.93, 55 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[bis(5-decoxycarbonyloxypentyl)amino]propyl-(6-hydroxyhexyl)amino]pentyl decyl carbonate is sourced from PubChem (CID 168999434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).