C28H57NO3 — CID 176936737
9-[decyl(4-hydroxybutyl)amino]nonyl 2-methylbutanoate (PubChem CID 176936737) has the molecular formula C28H57NO3 and a molecular weight of 455.77 g/mol. Its IUPAC name is 9-[decyl(4-hydroxybutyl)amino]nonyl 2-methylbutanoate.
| Compound Name | 9-[decyl(4-hydroxybutyl)amino]nonyl 2-methylbutanoate |
|---|---|
| PubChem CID | 176936737 |
| Molecular Formula | C28H57NO3 |
| Molecular Weight | 455.77 g/mol |
| Exact Mass | 455.43 |
| IUPAC Name | 9-[decyl(4-hydroxybutyl)amino]nonyl 2-methylbutanoate |
| SMILES | CCCCCCCCCCN(CCCCO)CCCCCCCCCOC(=O)C(C)CC |
| InChI | InChI=1S/C28H57NO3/c1-4-6-7-8-9-11-14-17-22-29(24-19-20-25-30)23-18-15-12-10-13-16-21-26-32-28(31)27(3)5-2/h27,30H,4-26H2,1-3H3 |
| InChIKey | JLHODHGTOLEHLT-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.77 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|