About 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate
1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate (PubChem CID 170431269) has the molecular formula C27H53NO5
and a molecular weight of 471.72 g/mol. Its IUPAC name is 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate.
Molecular Properties
| Compound Name | 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate |
| PubChem CID | 170431269 |
| Molecular Formula | C27H53NO5 |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.39 |
| IUPAC Name | 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate |
| SMILES | CCCCCCCCOC(=O)C(C)(CCCCCCNCCCO)C(=O)OCCCCCC |
| InChI | InChI=1S/C27H53NO5/c1-4-6-8-10-13-17-24-33-26(31)27(3,25(30)32-23-16-9-7-5-2)19-14-11-12-15-20-28-21-18-22-29/h28-29H,4-24H2,1-3H3 |
| InChIKey | NNXVKKZKMIBYHW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate?
The IUPAC name of 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate (CID 170431269) is 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate.
What is the SMILES notation for 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate?
The canonical SMILES for 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate is CCCCCCCCOC(=O)C(C)(CCCCCCNCCCO)C(=O)OCCCCCC.
What is the InChIKey of 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate?
The InChIKey is NNXVKKZKMIBYHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H53NO5/c1-4-6-8-10-13-17-24-33-26(31)27(3,25(30)32-23-16-9-7-5-2)19-14-11-12-15-20-28-21-18-22-29/h28-29H,4-24H2,1-3H3.
What are the key properties of 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate?
1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate has a molecular weight of 471.72 g/mol, XLogP of 5.94, 24 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-hexyl 3-O-octyl 2-[6-(3-hydroxypropylamino)hexyl]-2-methylpropanedioate is sourced from PubChem (CID 170431269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).