C56H111NO5 — CID 176602392
heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-hydroxybutyl)amino]-2,2-dimethyloctanoate (PubChem CID 176602392) has the molecular formula C56H111NO5 and a molecular weight of 878.51 g/mol. Its IUPAC name is heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-hydroxybutyl)amino]-2,2-dimethyloctanoate.
| Compound Name | heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-hydroxybutyl)amino]-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 176602392 |
| Molecular Formula | C56H111NO5 |
| Molecular Weight | 878.51 g/mol |
| Exact Mass | 877.85 |
| IUPAC Name | heptadecan-9-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(4-hydroxybutyl)amino]-2,2-dimethyloctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCO)CCCCCCC(C)(C)C(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C56H111NO5/c1-7-11-15-19-24-32-42-52(43-33-25-20-16-12-8-2)61-54(59)46-36-28-23-30-38-48-57(50-40-41-51-58)49-39-31-29-37-47-56(5,6)55(60)62-53(44-34-26-21-17-13-9-3)45-35-27-22-18-14-10-4/h52-53,58H,7-51H2,1-6H3 |
| InChIKey | FQRGXAOXQPQACH-UHFFFAOYSA-N |
| XLogP | 17.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.51 |
| LogP ≤ 5 | 17.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|