C20H41NO2 — CID 170351919
2-[methyl(octyl)amino]ethyl 2,2-dimethylheptanoate (PubChem CID 170351919) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is 2-[methyl(octyl)amino]ethyl 2,2-dimethylheptanoate.
| Compound Name | 2-[methyl(octyl)amino]ethyl 2,2-dimethylheptanoate |
|---|---|
| PubChem CID | 170351919 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | 2-[methyl(octyl)amino]ethyl 2,2-dimethylheptanoate |
| SMILES | CCCCCCCCN(C)CCOC(=O)C(C)(C)CCCCC |
| InChI | InChI=1S/C20H41NO2/c1-6-8-10-11-12-14-16-21(5)17-18-23-19(22)20(3,4)15-13-9-7-2/h6-18H2,1-5H3 |
| InChIKey | RVIPZPXQSQXZHJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|