C44H85NO6 — CID 169321357
didecyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 169321357) has the molecular formula C44H85NO6 and a molecular weight of 724.16 g/mol. Its IUPAC name is didecyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | didecyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321357 |
| Molecular Formula | C44H85NO6 |
| Molecular Weight | 724.16 g/mol |
| Exact Mass | 723.64 |
| IUPAC Name | didecyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(C)(C)CCCCCC(CCCCCC(C)(C)C(=O)OCCCCCCCCCC)OC(=O)CCN(C)C |
| InChI | InChI=1S/C44H85NO6/c1-9-11-13-15-17-19-21-29-37-49-41(47)43(3,4)34-27-23-25-31-39(51-40(46)33-36-45(7)8)32-26-24-28-35-44(5,6)42(48)50-38-30-22-20-18-16-14-12-10-2/h39H,9-38H2,1-8H3 |
| InChIKey | NFRJAZMYAFVETA-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.16 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|