C61H116N2O8 — CID 170975966
(8-heptadecan-9-yloxy-7,7-dimethyl-8-oxooctyl) (2S,4R)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate (PubChem CID 170975966) has the molecular formula C61H116N2O8 and a molecular weight of 1005.60 g/mol. Its IUPAC name is (8-heptadecan-9-yloxy-7,7-dimethyl-8-oxooctyl) (2S,4R)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate.
| Compound Name | (8-heptadecan-9-yloxy-7,7-dimethyl-8-oxooctyl) (2S,4R)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170975966 |
| Molecular Formula | C61H116N2O8 |
| Molecular Weight | 1005.60 g/mol |
| Exact Mass | 1004.87 |
| IUPAC Name | (8-heptadecan-9-yloxy-7,7-dimethyl-8-oxooctyl) (2S,4R)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)C(C)(C)CCCCCCOC(=O)[C@@H]1C[C@@H](OC(=O)CCN(C)C)CN1CCCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C61H116N2O8/c1-11-15-19-21-23-31-41-53(42-32-24-22-20-16-12-2)71-59(67)61(7,8)45-34-26-28-36-48-68-57(65)55-50-54(70-56(64)43-47-62(9)10)51-63(55)46-35-27-25-33-44-60(5,6)58(66)69-49-37-40-52(38-29-17-13-3)39-30-18-14-4/h52-55H,11-51H2,1-10H3/t54-,55+/m1/s1 |
| InChIKey | MYBNDKYZSFTDBJ-OMUYKDLESA-N |
| XLogP | 15.93 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.60 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|