C60H113N3O9 — CID 170975897
(8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-[2-(methylamino)ethylamino]-3-oxopropanoyl]oxypyrrolidine-2-carboxylate (PubChem CID 170975897) has the molecular formula C60H113N3O9 and a molecular weight of 1020.58 g/mol. Its IUPAC name is (8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-[2-(methylamino)ethylamino]-3-oxopropanoyl]oxypyrrolidine-2-carboxylate.
| Compound Name | (8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-[2-(methylamino)ethylamino]-3-oxopropanoyl]oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170975897 |
| Molecular Formula | C60H113N3O9 |
| Molecular Weight | 1020.58 g/mol |
| Exact Mass | 1019.85 |
| IUPAC Name | (8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-[2-(methylamino)ethylamino]-3-oxopropanoyl]oxypyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOC(=O)[C@@H]1C[C@H](OC(=O)CC(=O)NCCNC)CN1CCCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C60H113N3O9/c1-8-12-16-18-21-29-39-52(40-30-22-19-17-13-9-2)71-56(65)41-31-23-20-26-34-46-69-58(67)54-48-53(72-57(66)49-55(64)62-44-43-61-7)50-63(54)45-33-25-24-32-42-60(5,6)59(68)70-47-35-38-51(36-27-14-10-3)37-28-15-11-4/h51-54,61H,8-50H2,1-7H3,(H,62,64)/t53-,54-/m0/s1 |
| InChIKey | XADXLBHUFIUTEB-PJYGOTMFSA-N |
| XLogP | 14.07 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.58 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|