C64H123N3O7 — CID 174313573
4-pentylnonyl 8-[(4S)-2-[(8-heptadecan-9-yloxy-8-oxooctoxy)methyl]-4-[3-[methyl-(1-methylpiperidin-4-yl)amino]propanoyloxy]pyrrolidin-1-yl]-2,2-dimethyloctanoate (PubChem CID 174313573) has the molecular formula C64H123N3O7 and a molecular weight of 1046.70 g/mol. Its IUPAC name is 4-pentylnonyl 8-[(4S)-2-[(8-heptadecan-9-yloxy-8-oxooctoxy)methyl]-4-[3-[methyl-(1-methylpiperidin-4-yl)amino]propanoyloxy]pyrrolidin-1-yl]-2,2-dimethyloctanoate.
| Compound Name | 4-pentylnonyl 8-[(4S)-2-[(8-heptadecan-9-yloxy-8-oxooctoxy)methyl]-4-[3-[methyl-(1-methylpiperidin-4-yl)amino]propanoyloxy]pyrrolidin-1-yl]-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 174313573 |
| Molecular Formula | C64H123N3O7 |
| Molecular Weight | 1046.70 g/mol |
| Exact Mass | 1045.94 |
| IUPAC Name | 4-pentylnonyl 8-[(4S)-2-[(8-heptadecan-9-yloxy-8-oxooctoxy)methyl]-4-[3-[methyl-(1-methylpiperidin-4-yl)amino]propanoyloxy]pyrrolidin-1-yl]-2,2-dimethyloctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOCC1C[C@H](OC(=O)CCN(C)C2CCN(C)CC2)CN1CCCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C64H123N3O7/c1-9-13-17-19-22-30-40-59(41-31-23-20-18-14-10-2)73-61(68)42-32-24-21-27-35-51-71-55-58-53-60(74-62(69)45-50-66(8)57-43-48-65(7)49-44-57)54-67(58)47-34-26-25-33-46-64(5,6)63(70)72-52-36-39-56(37-28-15-11-3)38-29-16-12-4/h56-60H,9-55H2,1-8H3/t58?,60-/m0/s1 |
| InChIKey | DVZFOSREWCHXOX-TWQRDWNKSA-N |
| XLogP | 16.24 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.70 |
| LogP ≤ 5 | 16.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|