C58H112N2O7 — CID 174305583
4-pentylnonyl 8-[(4R)-4-[3-(dimethylamino)propanoyloxy]-2-[[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octoxy]methyl]pyrrolidin-1-yl]-2,2-dimethyloctanoate (PubChem CID 174305583) has the molecular formula C58H112N2O7 and a molecular weight of 949.54 g/mol. Its IUPAC name is 4-pentylnonyl 8-[(4R)-4-[3-(dimethylamino)propanoyloxy]-2-[[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octoxy]methyl]pyrrolidin-1-yl]-2,2-dimethyloctanoate.
| Compound Name | 4-pentylnonyl 8-[(4R)-4-[3-(dimethylamino)propanoyloxy]-2-[[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octoxy]methyl]pyrrolidin-1-yl]-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 174305583 |
| Molecular Formula | C58H112N2O7 |
| Molecular Weight | 949.54 g/mol |
| Exact Mass | 948.85 |
| IUPAC Name | 4-pentylnonyl 8-[(4R)-4-[3-(dimethylamino)propanoyloxy]-2-[[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octoxy]methyl]pyrrolidin-1-yl]-2,2-dimethyloctanoate |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)C(C)(C)CCCCCCOCC1C[C@@H](OC(=O)CCN(C)C)CN1CCCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C58H112N2O7/c1-11-15-23-33-50(34-24-16-12-2)37-31-45-65-55(62)57(5,6)40-27-19-21-29-42-60-48-53(67-54(61)39-43-59(9)10)47-52(60)49-64-44-30-22-20-28-41-58(7,8)56(63)66-46-32-38-51(35-25-17-13-3)36-26-18-14-4/h50-53H,11-49H2,1-10H3/t52?,53-/m1/s1 |
| InChIKey | YXZAEEVXRIZPLW-JYYSSWGDSA-N |
| XLogP | 15.09 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.54 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|