C58H110N2O8 — CID 170975982
[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl] (2S)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate (PubChem CID 170975982) has the molecular formula C58H110N2O8 and a molecular weight of 963.52 g/mol. Its IUPAC name is [7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl] (2S)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate.
| Compound Name | [7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl] (2S)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170975982 |
| Molecular Formula | C58H110N2O8 |
| Molecular Weight | 963.52 g/mol |
| Exact Mass | 962.83 |
| IUPAC Name | [7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl] (2S)-4-[3-(dimethylamino)propanoyloxy]-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)C(C)(C)CCCCCCOC(=O)[C@@H]1CC(OC(=O)CCN(C)C)CN1CCCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C58H110N2O8/c1-11-15-23-33-49(34-24-16-12-2)37-31-45-66-55(63)57(5,6)40-27-19-21-29-42-60-48-51(68-53(61)39-43-59(9)10)47-52(60)54(62)65-44-30-22-20-28-41-58(7,8)56(64)67-46-32-38-50(35-25-17-13-3)36-26-18-14-4/h49-52H,11-48H2,1-10H3/t51?,52-/m0/s1 |
| InChIKey | OWUQXSSQFAFOPY-KRIWGXSWSA-N |
| XLogP | 14.62 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.52 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|