C41H76N2O8 — CID 174140150
6-[(2S)-4-[3-(dimethylamino)propanoyloxy]-2-(8-heptadecan-9-yloxy-8-oxooctoxy)carbonylpyrrolidin-1-yl]hexanoic acid (PubChem CID 174140150) has the molecular formula C41H76N2O8 and a molecular weight of 725.06 g/mol. Its IUPAC name is 6-[(2S)-4-[3-(dimethylamino)propanoyloxy]-2-(8-heptadecan-9-yloxy-8-oxooctoxy)carbonylpyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[(2S)-4-[3-(dimethylamino)propanoyloxy]-2-(8-heptadecan-9-yloxy-8-oxooctoxy)carbonylpyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 174140150 |
| Molecular Formula | C41H76N2O8 |
| Molecular Weight | 725.06 g/mol |
| Exact Mass | 724.56 |
| IUPAC Name | 6-[(2S)-4-[3-(dimethylamino)propanoyloxy]-2-(8-heptadecan-9-yloxy-8-oxooctoxy)carbonylpyrrolidin-1-yl]hexanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOC(=O)[C@@H]1CC(OC(=O)CCN(C)C)CN1CCCCCC(=O)O |
| InChI | InChI=1S/C41H76N2O8/c1-5-7-9-11-14-19-25-35(26-20-15-12-10-8-6-2)50-39(46)28-22-16-13-17-24-32-49-41(48)37-33-36(51-40(47)29-31-42(3)4)34-43(37)30-23-18-21-27-38(44)45/h35-37H,5-34H2,1-4H3,(H,44,45)/t36?,37-/m0/s1 |
| InChIKey | IDDWUZVRLDGYBI-RWXFGYRSSA-N |
| XLogP | 8.87 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.06 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|