C62H116N2O9 — CID 170975863
(8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-(1,4-oxazepan-4-yl)propanoyloxy]pyrrolidine-2-carboxylate (PubChem CID 170975863) has the molecular formula C62H116N2O9 and a molecular weight of 1033.61 g/mol. Its IUPAC name is (8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-(1,4-oxazepan-4-yl)propanoyloxy]pyrrolidine-2-carboxylate.
| Compound Name | (8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-(1,4-oxazepan-4-yl)propanoyloxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170975863 |
| Molecular Formula | C62H116N2O9 |
| Molecular Weight | 1033.61 g/mol |
| Exact Mass | 1032.87 |
| IUPAC Name | (8-heptadecan-9-yloxy-8-oxooctyl) (2S,4S)-1-[7,7-dimethyl-8-oxo-8-(4-pentylnonoxy)octyl]-4-[3-(1,4-oxazepan-4-yl)propanoyloxy]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCOC(=O)[C@@H]1C[C@H](OC(=O)CCN2CCCOCC2)CN1CCCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C62H116N2O9/c1-7-11-15-17-20-28-39-55(40-29-21-18-16-12-8-2)72-58(65)41-30-22-19-25-33-49-70-60(67)57-52-56(73-59(66)42-46-63-44-35-48-69-51-47-63)53-64(57)45-32-24-23-31-43-62(5,6)61(68)71-50-34-38-54(36-26-13-9-3)37-27-14-10-4/h54-57H,7-53H2,1-6H3/t56-,57-/m0/s1 |
| InChIKey | PAHQHLQVPCOISC-KXLPFTAXSA-N |
| XLogP | 15.46 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.61 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|