C43H83NO6 — CID 169321287
dinonyl 8-[4-(dimethylamino)butanoyloxy]-3,3,13,13-tetramethylpentadecanedioate (PubChem CID 169321287) has the molecular formula C43H83NO6 and a molecular weight of 710.14 g/mol. Its IUPAC name is dinonyl 8-[4-(dimethylamino)butanoyloxy]-3,3,13,13-tetramethylpentadecanedioate.
| Compound Name | dinonyl 8-[4-(dimethylamino)butanoyloxy]-3,3,13,13-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321287 |
| Molecular Formula | C43H83NO6 |
| Molecular Weight | 710.14 g/mol |
| Exact Mass | 709.62 |
| IUPAC Name | dinonyl 8-[4-(dimethylamino)butanoyloxy]-3,3,13,13-tetramethylpentadecanedioate |
| SMILES | CCCCCCCCCOC(=O)CC(C)(C)CCCCC(CCCCC(C)(C)CC(=O)OCCCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C43H83NO6/c1-9-11-13-15-17-19-25-34-48-40(46)36-42(3,4)31-23-21-28-38(50-39(45)30-27-33-44(7)8)29-22-24-32-43(5,6)37-41(47)49-35-26-20-18-16-14-12-10-2/h38H,9-37H2,1-8H3 |
| InChIKey | MIGCSZWDTWCNMA-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.14 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|