C14H29NO2 — CID 90710467
2-[methyl(pentyl)amino]ethyl 2,2-dimethylbutanoate (PubChem CID 90710467) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[methyl(pentyl)amino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[methyl(pentyl)amino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90710467 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2-[methyl(pentyl)amino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCCCCN(C)CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C14H29NO2/c1-6-8-9-10-15(5)11-12-17-13(16)14(3,4)7-2/h6-12H2,1-5H3 |
| InChIKey | JGUVSAKKYZEHJB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|