C33H65NO4 — CID 171659227
3-ethylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate (PubChem CID 171659227) has the molecular formula C33H65NO4 and a molecular weight of 539.89 g/mol. Its IUPAC name is 3-ethylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate.
| Compound Name | 3-ethylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate |
|---|---|
| PubChem CID | 171659227 |
| Molecular Formula | C33H65NO4 |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 539.49 |
| IUPAC Name | 3-ethylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate |
| SMILES | CCCCCCCCC(CC)CCOC(=O)CCCCCC(CCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C33H65NO4/c1-6-9-11-13-15-17-22-30(8-3)27-29-37-32(35)25-20-16-19-24-31(23-18-14-12-10-7-2)38-33(36)26-21-28-34(4)5/h30-31H,6-29H2,1-5H3 |
| InChIKey | OSPJIUIVPJQTRN-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|