About 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate
6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate (PubChem CID 87579324) has the molecular formula C42H82O6
and a molecular weight of 683.11 g/mol. Its IUPAC name is 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate.
Molecular Properties
| Compound Name | 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate |
| PubChem CID | 87579324 |
| Molecular Formula | C42H82O6 |
| Molecular Weight | 683.11 g/mol |
| Exact Mass | 682.61 |
| IUPAC Name | 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)CCCCCCCCC(=O)OCCCCCCOC(=O)CCCCCCCCC(O)CCCCCCCC |
| InChI | InChI=1S/C42H82O6/c1-3-5-7-9-15-23-31-39(43)33-25-17-11-13-19-27-35-41(45)47-37-29-21-22-30-38-48-42(46)36-28-20-14-12-18-26-34-40(44)32-24-16-10-8-6-4-2/h39-40,43-44H,3-38H2,1-2H3 |
| InChIKey | BNQVVRTUMOWEGS-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 683.11 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate?
The IUPAC name of 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate (CID 87579324) is 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate.
What is the SMILES notation for 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate?
The canonical SMILES for 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate is CCCCCCCCC(O)CCCCCCCCC(=O)OCCCCCCOC(=O)CCCCCCCCC(O)CCCCCCCC.
What is the InChIKey of 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate?
The InChIKey is BNQVVRTUMOWEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H82O6/c1-3-5-7-9-15-23-31-39(43)33-25-17-11-13-19-27-35-41(45)47-37-29-21-22-30-38-48-42(46)36-28-20-14-12-18-26-34-40(44)32-24-16-10-8-6-4-2/h39-40,43-44H,3-38H2,1-2H3.
What are the key properties of 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate?
6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate has a molecular weight of 683.11 g/mol, XLogP of 12.10, 39 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(10-hydroxyoctadecanoyloxy)hexyl 10-hydroxyoctadecanoate is sourced from PubChem (CID 87579324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).