About ethyl hexanoate;icosan-9-ol
ethyl hexanoate;icosan-9-ol (PubChem CID 170307384) has the molecular formula C28H58O3
and a molecular weight of 442.77 g/mol. Its IUPAC name is ethyl hexanoate;icosan-9-ol.
Molecular Properties
| Compound Name | ethyl hexanoate;icosan-9-ol |
| PubChem CID | 170307384 |
| Molecular Formula | C28H58O3 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.44 |
| IUPAC Name | ethyl hexanoate;icosan-9-ol |
| SMILES | CCCCCC(=O)OCC.CCCCCCCCCCCC(O)CCCCCCCC |
| InChI | InChI=1S/C20H42O.C8H16O2/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2;1-3-5-6-7-8(9)10-4-2/h20-21H,3-19H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | YQBVAFHHOTZJLF-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl hexanoate;icosan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl hexanoate;icosan-9-ol?
The IUPAC name of ethyl hexanoate;icosan-9-ol (CID 170307384) is ethyl hexanoate;icosan-9-ol.
What is the SMILES notation for ethyl hexanoate;icosan-9-ol?
The canonical SMILES for ethyl hexanoate;icosan-9-ol is CCCCCC(=O)OCC.CCCCCCCCCCCC(O)CCCCCCCC.
What is the InChIKey of ethyl hexanoate;icosan-9-ol?
The InChIKey is YQBVAFHHOTZJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O.C8H16O2/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2;1-3-5-6-7-8(9)10-4-2/h20-21H,3-19H2,1-2H3;3-7H2,1-2H3.
What are the key properties of ethyl hexanoate;icosan-9-ol?
ethyl hexanoate;icosan-9-ol has a molecular weight of 442.77 g/mol, XLogP of 9.15, 22 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl hexanoate;icosan-9-ol is sourced from PubChem (CID 170307384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).