C49H93N3O5 — CID 176869635
3-pentyldecyl 6-hydroxy-7-[2-imidazol-1-ylethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate (PubChem CID 176869635) has the molecular formula C49H93N3O5 and a molecular weight of 804.30 g/mol. Its IUPAC name is 3-pentyldecyl 6-hydroxy-7-[2-imidazol-1-ylethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate.
| Compound Name | 3-pentyldecyl 6-hydroxy-7-[2-imidazol-1-ylethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
|---|---|
| PubChem CID | 176869635 |
| Molecular Formula | C49H93N3O5 |
| Molecular Weight | 804.30 g/mol |
| Exact Mass | 803.71 |
| IUPAC Name | 3-pentyldecyl 6-hydroxy-7-[2-imidazol-1-ylethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCCCN(CCn1ccnc1)CC(O)CCCCC(=O)OCCC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C49H93N3O5/c1-5-9-13-15-21-29-45(27-19-11-7-3)34-41-56-48(54)32-23-17-18-26-37-51(39-40-52-38-36-50-44-52)43-47(53)31-24-25-33-49(55)57-42-35-46(28-20-12-8-4)30-22-16-14-10-6-2/h36,38,44-47,53H,5-35,37,39-43H2,1-4H3 |
| InChIKey | MEUPGUFTVIMGBZ-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.30 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|