C50H95N3O5 — CID 178085180
3-pentyldecyl 6-hydroxy-7-[2-(4-methylimidazol-1-yl)ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate (PubChem CID 178085180) has the molecular formula C50H95N3O5 and a molecular weight of 818.33 g/mol. Its IUPAC name is 3-pentyldecyl 6-hydroxy-7-[2-(4-methylimidazol-1-yl)ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate.
| Compound Name | 3-pentyldecyl 6-hydroxy-7-[2-(4-methylimidazol-1-yl)ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
|---|---|
| PubChem CID | 178085180 |
| Molecular Formula | C50H95N3O5 |
| Molecular Weight | 818.33 g/mol |
| Exact Mass | 817.73 |
| IUPAC Name | 3-pentyldecyl 6-hydroxy-7-[2-(4-methylimidazol-1-yl)ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCCCN(CCn1cnc(C)c1)CC(O)CCCCC(=O)OCCC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C50H95N3O5/c1-6-10-14-16-22-30-46(28-20-12-8-3)35-40-57-49(55)33-24-18-19-27-37-52(38-39-53-42-45(5)51-44-53)43-48(54)32-25-26-34-50(56)58-41-36-47(29-21-13-9-4)31-23-17-15-11-7-2/h42,44,46-48,54H,6-41,43H2,1-5H3 |
| InChIKey | IUTRVPVRQKTILV-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.33 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|