C50H95N3O6 — CID 176870374
[(5S)-6-[[(2R)-6-(2-hexyldecanoyloxy)-2-hydroxyhexyl]-(3-imidazol-1-ylpropyl)amino]-5-hydroxyhexyl] 2-hexyldecanoate (PubChem CID 176870374) has the molecular formula C50H95N3O6 and a molecular weight of 834.32 g/mol. Its IUPAC name is [(5S)-6-[[(2R)-6-(2-hexyldecanoyloxy)-2-hydroxyhexyl]-(3-imidazol-1-ylpropyl)amino]-5-hydroxyhexyl] 2-hexyldecanoate.
| Compound Name | [(5S)-6-[[(2R)-6-(2-hexyldecanoyloxy)-2-hydroxyhexyl]-(3-imidazol-1-ylpropyl)amino]-5-hydroxyhexyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 176870374 |
| Molecular Formula | C50H95N3O6 |
| Molecular Weight | 834.32 g/mol |
| Exact Mass | 833.72 |
| IUPAC Name | [(5S)-6-[[(2R)-6-(2-hexyldecanoyloxy)-2-hydroxyhexyl]-(3-imidazol-1-ylpropyl)amino]-5-hydroxyhexyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCC[C@@H](O)CN(CCCn1ccnc1)C[C@@H](O)CCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H95N3O6/c1-5-9-13-17-19-23-32-45(30-21-15-11-7-3)49(56)58-40-27-25-34-47(54)42-53(38-29-37-52-39-36-51-44-52)43-48(55)35-26-28-41-59-50(57)46(31-22-16-12-8-4)33-24-20-18-14-10-6-2/h36,39,44-48,54-55H,5-35,37-38,40-43H2,1-4H3/t45?,46?,47-,48+ |
| InChIKey | WBWBZWRZCAYYMR-GWNMJRRJSA-N |
| XLogP | 12.40 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.32 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|