C30H57N3O2 — CID 156751259
6-[2-imidazol-1-ylethyl(propyl)amino]hexyl 2-hexyldecanoate (PubChem CID 156751259) has the molecular formula C30H57N3O2 and a molecular weight of 491.81 g/mol. Its IUPAC name is 6-[2-imidazol-1-ylethyl(propyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[2-imidazol-1-ylethyl(propyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 156751259 |
| Molecular Formula | C30H57N3O2 |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.45 |
| IUPAC Name | 6-[2-imidazol-1-ylethyl(propyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCC)CCn1ccnc1 |
| InChI | InChI=1S/C30H57N3O2/c1-4-7-9-11-12-16-20-29(19-15-10-8-5-2)30(34)35-27-18-14-13-17-23-32(22-6-3)25-26-33-24-21-31-28-33/h21,24,28-29H,4-20,22-23,25-27H2,1-3H3 |
| InChIKey | OUBGEVQBAPYVIT-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|