C45H91NO5 — CID 142497720
heptadecan-9-yl formate;heptyl 10-[2-hydroxyethyl(octyl)amino]decanoate (PubChem CID 142497720) has the molecular formula C45H91NO5 and a molecular weight of 726.22 g/mol. Its IUPAC name is heptadecan-9-yl formate;heptyl 10-[2-hydroxyethyl(octyl)amino]decanoate.
| Compound Name | heptadecan-9-yl formate;heptyl 10-[2-hydroxyethyl(octyl)amino]decanoate |
|---|---|
| PubChem CID | 142497720 |
| Molecular Formula | C45H91NO5 |
| Molecular Weight | 726.22 g/mol |
| Exact Mass | 725.69 |
| IUPAC Name | heptadecan-9-yl formate;heptyl 10-[2-hydroxyethyl(octyl)amino]decanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC=O.CCCCCCCCN(CCO)CCCCCCCCCC(=O)OCCCCCCC |
| InChI | InChI=1S/C27H55NO3.C18H36O2/c1-3-5-7-9-14-18-22-28(24-25-29)23-19-15-12-10-11-13-17-21-27(30)31-26-20-16-8-6-4-2;1-3-5-7-9-11-13-15-18(20-17-19)16-14-12-10-8-6-4-2/h29H,3-26H2,1-2H3;17-18H,3-16H2,1-2H3 |
| InChIKey | ISJIJMQCYKJNHD-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.22 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|