C49H96N2O5 — CID 167180905
3-butylheptyl 8-[3-acetamidopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 167180905) has the molecular formula C49H96N2O5 and a molecular weight of 793.32 g/mol. Its IUPAC name is 3-butylheptyl 8-[3-acetamidopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | 3-butylheptyl 8-[3-acetamidopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 167180905 |
| Molecular Formula | C49H96N2O5 |
| Molecular Weight | 793.32 g/mol |
| Exact Mass | 792.73 |
| IUPAC Name | 3-butylheptyl 8-[3-acetamidopropyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCC(CCCC)CCCC)CCCNC(C)=O |
| InChI | InChI=1S/C49H96N2O5/c1-6-10-14-16-20-26-35-47(36-27-21-17-15-11-7-2)56-49(54)38-29-23-19-25-31-42-51(43-32-40-50-45(5)52)41-30-24-18-22-28-37-48(53)55-44-39-46(33-12-8-3)34-13-9-4/h46-47H,6-44H2,1-5H3,(H,50,52) |
| InChIKey | ZUDRYIVULXIFEL-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.32 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|