C45H89N3O4S — CID 175629643
nonyl 8-[3-(dimethylcarbamothioylamino)propyl-(8-oxo-8-tetradecan-6-yloxyoctyl)amino]octanoate (PubChem CID 175629643) has the molecular formula C45H89N3O4S and a molecular weight of 768.29 g/mol. Its IUPAC name is nonyl 8-[3-(dimethylcarbamothioylamino)propyl-(8-oxo-8-tetradecan-6-yloxyoctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-(dimethylcarbamothioylamino)propyl-(8-oxo-8-tetradecan-6-yloxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 175629643 |
| Molecular Formula | C45H89N3O4S |
| Molecular Weight | 768.29 g/mol |
| Exact Mass | 767.66 |
| IUPAC Name | nonyl 8-[3-(dimethylcarbamothioylamino)propyl-(8-oxo-8-tetradecan-6-yloxyoctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCC)CCCCCCCC)CCCNC(=S)N(C)C |
| InChI | InChI=1S/C45H89N3O4S/c1-6-9-12-14-16-24-31-41-51-43(49)35-27-20-17-22-29-38-48(40-32-37-46-45(53)47(4)5)39-30-23-18-21-28-36-44(50)52-42(33-25-11-8-3)34-26-19-15-13-10-7-2/h42H,6-41H2,1-5H3,(H,46,53) |
| InChIKey | KLPDGPQTLCADCJ-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.29 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|