C44H87N3O4S — CID 155278429
decan-3-yl 8-[3-(dimethylcarbamothioylamino)propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 155278429) has the molecular formula C44H87N3O4S and a molecular weight of 754.26 g/mol. Its IUPAC name is decan-3-yl 8-[3-(dimethylcarbamothioylamino)propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | decan-3-yl 8-[3-(dimethylcarbamothioylamino)propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 155278429 |
| Molecular Formula | C44H87N3O4S |
| Molecular Weight | 754.26 g/mol |
| Exact Mass | 753.64 |
| IUPAC Name | decan-3-yl 8-[3-(dimethylcarbamothioylamino)propyl-(8-dodecan-6-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCC)CCCCCC)CCCNC(=S)N(C)C |
| InChI | InChI=1S/C44H87N3O4S/c1-7-11-14-18-25-31-40(10-4)50-42(48)34-26-19-16-21-28-37-47(39-30-36-45-44(52)46(5)6)38-29-22-17-20-27-35-43(49)51-41(32-23-13-9-3)33-24-15-12-8-2/h40-41H,7-39H2,1-6H3,(H,45,52) |
| InChIKey | SGGZPOSOGLXUGO-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.26 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|