C42H83N3O4S — CID 155720158
7-[3-(dimethylcarbamothioylamino)propyl-(8-octoxy-8-oxooctyl)amino]heptyl 2-pentyloctanoate (PubChem CID 155720158) has the molecular formula C42H83N3O4S and a molecular weight of 726.21 g/mol. Its IUPAC name is 7-[3-(dimethylcarbamothioylamino)propyl-(8-octoxy-8-oxooctyl)amino]heptyl 2-pentyloctanoate.
| Compound Name | 7-[3-(dimethylcarbamothioylamino)propyl-(8-octoxy-8-oxooctyl)amino]heptyl 2-pentyloctanoate |
|---|---|
| PubChem CID | 155720158 |
| Molecular Formula | C42H83N3O4S |
| Molecular Weight | 726.21 g/mol |
| Exact Mass | 725.61 |
| IUPAC Name | 7-[3-(dimethylcarbamothioylamino)propyl-(8-octoxy-8-oxooctyl)amino]heptyl 2-pentyloctanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCN(CCCCCCCOC(=O)C(CCCCC)CCCCCC)CCCNC(=S)N(C)C |
| InChI | InChI=1S/C42H83N3O4S/c1-6-9-12-14-20-27-37-48-40(46)32-24-17-15-18-25-34-45(36-29-33-43-42(50)44(4)5)35-26-19-16-21-28-38-49-41(47)39(30-22-11-8-3)31-23-13-10-7-2/h39H,6-38H2,1-5H3,(H,43,50) |
| InChIKey | WHSHWRCVIWRIMK-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.21 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|