C48H93N5O4 — CID 170776526
7-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate (PubChem CID 170776526) has the molecular formula C48H93N5O4 and a molecular weight of 804.30 g/mol. Its IUPAC name is 7-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate.
| Compound Name | 7-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate |
|---|---|
| PubChem CID | 170776526 |
| Molecular Formula | C48H93N5O4 |
| Molecular Weight | 804.30 g/mol |
| Exact Mass | 803.72 |
| IUPAC Name | 7-[3-[(N-cyano-N'-methylcarbamimidoyl)amino]propyl-(8-nonoxy-8-oxooctyl)amino]heptyl 2-octyldecanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCOC(=O)C(CCCCCCCC)CCCCCCCC)CCCN/C(=N/C)NC#N |
| InChI | InChI=1S/C48H93N5O4/c1-5-8-11-14-17-25-32-42-56-46(54)37-29-22-18-23-30-39-53(41-34-38-51-48(50-4)52-44-49)40-31-24-19-26-33-43-57-47(55)45(35-27-20-15-12-9-6-2)36-28-21-16-13-10-7-3/h45H,5-43H2,1-4H3,(H2,50,51,52) |
| InChIKey | KBAIQGNJZISEKC-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.30 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|