C51H101N5O4 — CID 177064195
ethane;nonyl 8-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 177064195) has the molecular formula C51H101N5O4 and a molecular weight of 848.40 g/mol. Its IUPAC name is ethane;nonyl 8-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | ethane;nonyl 8-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 177064195 |
| Molecular Formula | C51H101N5O4 |
| Molecular Weight | 848.40 g/mol |
| Exact Mass | 847.79 |
| IUPAC Name | ethane;nonyl 8-[3-[[(cyanoamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CC.CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCC/N=C(/NC#N)N(C)C |
| InChI | InChI=1S/C49H95N5O4.C2H6/c1-6-9-12-15-18-27-34-44-57-47(55)38-30-23-19-25-32-41-54(43-35-40-51-49(52-45-50)53(4)5)42-33-26-20-24-31-39-48(56)58-46(36-28-21-16-13-10-7-2)37-29-22-17-14-11-8-3;1-2/h46H,6-44H2,1-5H3,(H,51,52);1-2H3 |
| InChIKey | RFQFVJPCKZQZCD-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.40 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|