C48H94N6O3 — CID 171538980
nonyl 8-[2-[[(cyanoamino)-(dimethylamino)methylidene]amino]ethyl-[8-(heptadecan-9-ylamino)-8-oxooctyl]amino]octanoate (PubChem CID 171538980) has the molecular formula C48H94N6O3 and a molecular weight of 803.32 g/mol. Its IUPAC name is nonyl 8-[2-[[(cyanoamino)-(dimethylamino)methylidene]amino]ethyl-[8-(heptadecan-9-ylamino)-8-oxooctyl]amino]octanoate.
| Compound Name | nonyl 8-[2-[[(cyanoamino)-(dimethylamino)methylidene]amino]ethyl-[8-(heptadecan-9-ylamino)-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 171538980 |
| Molecular Formula | C48H94N6O3 |
| Molecular Weight | 803.32 g/mol |
| Exact Mass | 802.74 |
| IUPAC Name | nonyl 8-[2-[[(cyanoamino)-(dimethylamino)methylidene]amino]ethyl-[8-(heptadecan-9-ylamino)-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)NC(CCCCCCCC)CCCCCCCC)CC/N=C(/NC#N)N(C)C |
| InChI | InChI=1S/C48H94N6O3/c1-6-9-12-15-18-27-34-43-57-47(56)38-31-24-20-26-33-41-54(42-39-50-48(51-44-49)53(4)5)40-32-25-19-23-30-37-46(55)52-45(35-28-21-16-13-10-7-2)36-29-22-17-14-11-8-3/h45H,6-43H2,1-5H3,(H,50,51)(H,52,55) |
| InChIKey | VARWEXJZCBFZRS-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.32 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|