C52H102N2O5 — CID 118403770
bis(3-pentyloctyl) 11-[3-(dimethylamino)propanoylamino]henicosanedioate (PubChem CID 118403770) has the molecular formula C52H102N2O5 and a molecular weight of 835.40 g/mol. Its IUPAC name is bis(3-pentyloctyl) 11-[3-(dimethylamino)propanoylamino]henicosanedioate.
| Compound Name | bis(3-pentyloctyl) 11-[3-(dimethylamino)propanoylamino]henicosanedioate |
|---|---|
| PubChem CID | 118403770 |
| Molecular Formula | C52H102N2O5 |
| Molecular Weight | 835.40 g/mol |
| Exact Mass | 834.78 |
| IUPAC Name | bis(3-pentyloctyl) 11-[3-(dimethylamino)propanoylamino]henicosanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(CCCCC)CCCCC)NC(=O)CCN(C)C |
| InChI | InChI=1S/C52H102N2O5/c1-7-11-25-33-47(34-26-12-8-2)42-45-58-51(56)39-31-23-19-15-17-21-29-37-49(53-50(55)41-44-54(5)6)38-30-22-18-16-20-24-32-40-52(57)59-46-43-48(35-27-13-9-3)36-28-14-10-4/h47-49H,7-46H2,1-6H3,(H,53,55) |
| InChIKey | WKDYKDWPOIYZGI-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.40 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|