C36H73N3O3 — CID 170739582
3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate (PubChem CID 170739582) has the molecular formula C36H73N3O3 and a molecular weight of 596.00 g/mol. Its IUPAC name is 3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate.
| Compound Name | 3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate |
|---|---|
| PubChem CID | 170739582 |
| Molecular Formula | C36H73N3O3 |
| Molecular Weight | 596.00 g/mol |
| Exact Mass | 595.57 |
| IUPAC Name | 3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)NC(=O)NCCCN(C)C |
| InChI | InChI=1S/C36H73N3O3/c1-6-9-12-13-15-20-26-34(38-36(41)37-30-23-31-39(4)5)27-21-16-14-17-22-28-35(40)42-32-29-33(24-18-10-7-2)25-19-11-8-3/h33-34H,6-32H2,1-5H3,(H2,37,38,41) |
| InChIKey | NGICVYMETGGFKL-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.00 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|