C50H101N3O5 — CID 170739581
3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate;3-pentyloctyl formate (PubChem CID 170739581) has the molecular formula C50H101N3O5 and a molecular weight of 824.37 g/mol. Its IUPAC name is 3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate;3-pentyloctyl formate.
| Compound Name | 3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate;3-pentyloctyl formate |
|---|---|
| PubChem CID | 170739581 |
| Molecular Formula | C50H101N3O5 |
| Molecular Weight | 824.37 g/mol |
| Exact Mass | 823.77 |
| IUPAC Name | 3-pentyloctyl 9-[3-(dimethylamino)propylcarbamoylamino]heptadecanoate;3-pentyloctyl formate |
| SMILES | CCCCCC(CCCCC)CCOC=O.CCCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)NC(=O)NCCCN(C)C |
| InChI | InChI=1S/C36H73N3O3.C14H28O2/c1-6-9-12-13-15-20-26-34(38-36(41)37-30-23-31-39(4)5)27-21-16-14-17-22-28-35(40)42-32-29-33(24-18-10-7-2)25-19-11-8-3;1-3-5-7-9-14(10-8-6-4-2)11-12-16-13-15/h33-34H,6-32H2,1-5H3,(H2,37,38,41);13-14H,3-12H2,1-2H3 |
| InChIKey | CMPKUZUKLOSPHD-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.37 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|