C49H101N3O4S — CID 176935630
bis(3-pentyloctyl) 9-[3-(dimethylamino)propylcarbamothioylamino]heptadecanedioate;molecular hydrogen (PubChem CID 176935630) has the molecular formula C49H101N3O4S and a molecular weight of 828.43 g/mol. Its IUPAC name is bis(3-pentyloctyl) 9-[3-(dimethylamino)propylcarbamothioylamino]heptadecanedioate;molecular hydrogen.
| Compound Name | bis(3-pentyloctyl) 9-[3-(dimethylamino)propylcarbamothioylamino]heptadecanedioate;molecular hydrogen |
|---|---|
| PubChem CID | 176935630 |
| Molecular Formula | C49H101N3O4S |
| Molecular Weight | 828.43 g/mol |
| Exact Mass | 827.75 |
| IUPAC Name | bis(3-pentyloctyl) 9-[3-(dimethylamino)propylcarbamothioylamino]heptadecanedioate;molecular hydrogen |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)NC(=S)NCCCN(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C49H97N3O4S.2H2/c1-7-11-21-30-44(31-22-12-8-2)38-42-55-47(53)36-27-19-15-17-25-34-46(51-49(57)50-40-29-41-52(5)6)35-26-18-16-20-28-37-48(54)56-43-39-45(32-23-13-9-3)33-24-14-10-4;;/h44-46H,7-43H2,1-6H3,(H2,50,51,57);2*1H |
| InChIKey | WXSXJQGITNIJAK-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.43 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|