C47H94N2O4 — CID 123666707
3-pentyloctyl 9-[[2-(dimethylamino)acetyl]amino]-17-(3-pentyloctoxy)heptadecanoate (PubChem CID 123666707) has the molecular formula C47H94N2O4 and a molecular weight of 751.28 g/mol. Its IUPAC name is 3-pentyloctyl 9-[[2-(dimethylamino)acetyl]amino]-17-(3-pentyloctoxy)heptadecanoate.
| Compound Name | 3-pentyloctyl 9-[[2-(dimethylamino)acetyl]amino]-17-(3-pentyloctoxy)heptadecanoate |
|---|---|
| PubChem CID | 123666707 |
| Molecular Formula | C47H94N2O4 |
| Molecular Weight | 751.28 g/mol |
| Exact Mass | 750.72 |
| IUPAC Name | 3-pentyloctyl 9-[[2-(dimethylamino)acetyl]amino]-17-(3-pentyloctoxy)heptadecanoate |
| SMILES | CCCCCC(CCCCC)CCOCCCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)NC(=O)CN(C)C |
| InChI | InChI=1S/C47H94N2O4/c1-7-11-22-30-43(31-23-12-8-2)37-40-52-39-29-21-16-15-18-26-34-45(48-46(50)42-49(5)6)35-27-19-17-20-28-36-47(51)53-41-38-44(32-24-13-9-3)33-25-14-10-4/h43-45H,7-42H2,1-6H3,(H,48,50) |
| InChIKey | CDPGFJDMCHCTEP-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.28 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|