C48H97N5O4S — CID 146475490
nonyl 8-[3-[[(aminosulfanylamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 146475490) has the molecular formula C48H97N5O4S and a molecular weight of 840.40 g/mol. Its IUPAC name is nonyl 8-[3-[[(aminosulfanylamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-[[(aminosulfanylamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 146475490 |
| Molecular Formula | C48H97N5O4S |
| Molecular Weight | 840.40 g/mol |
| Exact Mass | 839.73 |
| IUPAC Name | nonyl 8-[3-[[(aminosulfanylamino)-(dimethylamino)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCC/N=C(/NSN)N(C)C |
| InChI | InChI=1S/C48H97N5O4S/c1-6-9-12-15-18-27-34-44-56-46(54)38-30-23-19-25-32-41-53(43-35-40-50-48(51-58-49)52(4)5)42-33-26-20-24-31-39-47(55)57-45(36-28-21-16-13-10-7-2)37-29-22-17-14-11-8-3/h45H,6-44,49H2,1-5H3,(H,50,51) |
| InChIKey | PACFXDJFSZMAOJ-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.40 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|