C63H111N5O10S2 — CID 175892778
benzhydrylsulfonylcarbamic acid;nonyl 8-[3-[[dimethylamino(methanesulfonamido)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 175892778) has the molecular formula C63H111N5O10S2 and a molecular weight of 1162.74 g/mol. Its IUPAC name is benzhydrylsulfonylcarbamic acid;nonyl 8-[3-[[dimethylamino(methanesulfonamido)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | benzhydrylsulfonylcarbamic acid;nonyl 8-[3-[[dimethylamino(methanesulfonamido)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 175892778 |
| Molecular Formula | C63H111N5O10S2 |
| Molecular Weight | 1162.74 g/mol |
| Exact Mass | 1161.78 |
| IUPAC Name | benzhydrylsulfonylcarbamic acid;nonyl 8-[3-[[dimethylamino(methanesulfonamido)methylidene]amino]propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCC/N=C(/NS(C)(=O)=O)N(C)C.O=C(O)NS(=O)(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H98N4O6S.C14H13NO4S/c1-7-10-13-16-19-28-35-45-58-47(54)39-31-24-20-26-33-42-53(44-36-41-50-49(52(4)5)51-60(6,56)57)43-34-27-21-25-32-40-48(55)59-46(37-29-22-17-14-11-8-2)38-30-23-18-15-12-9-3;16-14(17)15-20(18,19)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h46H,7-45H2,1-6H3,(H,50,51);1-10,13,15H,(H,16,17) |
| InChIKey | NQTMXWHYEFACRJ-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 201.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1162.74 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|