C53H96N2O6 — CID 167389061
nonyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate (PubChem CID 167389061) has the molecular formula C53H96N2O6 and a molecular weight of 857.36 g/mol. Its IUPAC name is nonyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate.
| Compound Name | nonyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 167389061 |
| Molecular Formula | C53H96N2O6 |
| Molecular Weight | 857.36 g/mol |
| Exact Mass | 856.73 |
| IUPAC Name | nonyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCCC)CCCNC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C53H96N2O6/c1-4-7-10-13-15-24-34-46-60-52(57)40-30-20-16-22-32-43-55(45-35-42-54-51(56)48-59-47-49-36-26-25-27-37-49)44-33-23-17-21-31-41-53(58)61-50(38-28-18-12-9-6-3)39-29-19-14-11-8-5-2/h25-27,36-37,50H,4-24,28-35,38-48H2,1-3H3,(H,54,56) |
| InChIKey | RUTUPNBYAFWVFW-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.36 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|