C51H93NO5 — CID 169030231
4-(4-hexylphenyl)butyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate (PubChem CID 169030231) has the molecular formula C51H93NO5 and a molecular weight of 800.31 g/mol. Its IUPAC name is 4-(4-hexylphenyl)butyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate.
| Compound Name | 4-(4-hexylphenyl)butyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 169030231 |
| Molecular Formula | C51H93NO5 |
| Molecular Weight | 800.31 g/mol |
| Exact Mass | 799.71 |
| IUPAC Name | 4-(4-hexylphenyl)butyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OCCCCc1ccc(CCCCCC)cc1 |
| InChI | InChI=1S/C51H93NO5/c1-4-7-10-13-17-24-34-49(35-25-18-14-11-8-5-2)57-51(55)37-27-20-16-22-30-43-52(44-45-53)42-29-21-15-19-26-36-50(54)56-46-31-28-33-48-40-38-47(39-41-48)32-23-12-9-6-3/h38-41,49,53H,4-37,42-46H2,1-3H3 |
| InChIKey | RUFGAZQNUYHZDE-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.31 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|