C37H66N2O4 — CID 167147590
nonyl 8-[octyl-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate (PubChem CID 167147590) has the molecular formula C37H66N2O4 and a molecular weight of 602.95 g/mol. Its IUPAC name is nonyl 8-[octyl-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate.
| Compound Name | nonyl 8-[octyl-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 167147590 |
| Molecular Formula | C37H66N2O4 |
| Molecular Weight | 602.95 g/mol |
| Exact Mass | 602.50 |
| IUPAC Name | nonyl 8-[octyl-[3-[(2-phenylmethoxyacetyl)amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC)CCCNC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C37H66N2O4/c1-3-5-7-9-11-16-23-32-43-37(41)27-20-13-12-15-22-30-39(29-21-14-10-8-6-4-2)31-24-28-38-36(40)34-42-33-35-25-18-17-19-26-35/h17-19,25-26H,3-16,20-24,27-34H2,1-2H3,(H,38,40) |
| InChIKey | BMFCYZSTMOJHBJ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.95 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|