C48H95N3O4S — CID 139581689
7-[3-(dimethylcarbamothioylamino)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]heptyl decanoate (PubChem CID 139581689) has the molecular formula C48H95N3O4S and a molecular weight of 810.37 g/mol. Its IUPAC name is 7-[3-(dimethylcarbamothioylamino)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]heptyl decanoate.
| Compound Name | 7-[3-(dimethylcarbamothioylamino)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]heptyl decanoate |
|---|---|
| PubChem CID | 139581689 |
| Molecular Formula | C48H95N3O4S |
| Molecular Weight | 810.37 g/mol |
| Exact Mass | 809.70 |
| IUPAC Name | 7-[3-(dimethylcarbamothioylamino)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]heptyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC(=S)N(C)C |
| InChI | InChI=1S/C48H95N3O4S/c1-6-9-12-15-18-23-30-38-46(52)54-44-34-27-20-26-33-42-51(43-35-40-49-48(56)50(4)5)41-32-25-19-24-31-39-47(53)55-45(36-28-21-16-13-10-7-2)37-29-22-17-14-11-8-3/h45H,6-44H2,1-5H3,(H,49,56) |
| InChIKey | JJGCEFLCKZSMOA-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.37 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|