C51H100N2O6 — CID 174316997
dodecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methoxyacetyl)amino]propyl]amino]octanoate (PubChem CID 174316997) has the molecular formula C51H100N2O6 and a molecular weight of 837.37 g/mol. Its IUPAC name is dodecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methoxyacetyl)amino]propyl]amino]octanoate.
| Compound Name | dodecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methoxyacetyl)amino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 174316997 |
| Molecular Formula | C51H100N2O6 |
| Molecular Weight | 837.37 g/mol |
| Exact Mass | 836.76 |
| IUPAC Name | dodecan-3-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-[(2-methoxyacetyl)amino]propyl]amino]octanoate |
| SMILES | CCCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCNC(=O)COC |
| InChI | InChI=1S/C51H100N2O6/c1-6-10-13-16-19-24-29-37-47(9-4)58-50(55)40-32-25-20-27-34-43-53(45-36-42-52-49(54)46-57-5)44-35-28-21-26-33-41-51(56)59-48(38-30-22-17-14-11-7-2)39-31-23-18-15-12-8-3/h47-48H,6-46H2,1-5H3,(H,52,54) |
| InChIKey | XDIYVTNVNQODMO-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.37 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|